C10H16O2 — CID 102446891
(4aR,7Z,10aS)-2,3,4,4a,6,9,10,10a-octahydropyrano[3,2-b]oxocine (PubChem CID 102446891) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (4aR,7Z,10aS)-2,3,4,4a,6,9,10,10a-octahydropyrano[3,2-b]oxocine.
| Compound Name | (4aR,7Z,10aS)-2,3,4,4a,6,9,10,10a-octahydropyrano[3,2-b]oxocine |
|---|---|
| PubChem CID | 102446891 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (4aR,7Z,10aS)-2,3,4,4a,6,9,10,10a-octahydropyrano[3,2-b]oxocine |
| SMILES | C1=C\CO[C@@H]2CCCO[C@H]2CC/1 |
| InChI | InChI=1S/C10H16O2/c1-2-5-9-10(11-7-3-1)6-4-8-12-9/h1,3,9-10H,2,4-8H2/b3-1-/t9-,10+/m0/s1 |
| InChIKey | GVOFUIRTOLAXCX-PSMNYDHOSA-N |
| XLogP | 1.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|