C26H40O7Si2 — CID 102446916
(1S,2S,5S,7R,10R,12R,13S)-12-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-trimethylsilyloxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-ol (PubChem CID 102446916) has the molecular formula C26H40O7Si2 and a molecular weight of 520.77 g/mol. Its IUPAC name is (1S,2S,5S,7R,10R,12R,13S)-12-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-trimethylsilyloxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-ol.
| Compound Name | (1S,2S,5S,7R,10R,12R,13S)-12-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-trimethylsilyloxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-ol |
|---|---|
| PubChem CID | 102446916 |
| Molecular Formula | C26H40O7Si2 |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (1S,2S,5S,7R,10R,12R,13S)-12-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10-trimethylsilyloxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-ol |
| SMILES | CC1(C)OC[C@H]([C@@]23C#C[C@]4(O[Si](C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]5O[C@@]54[C@@H](O)C#C[C@@H]2O3)O1 |
| InChI | InChI=1S/C26H40O7Si2/c1-22(2,3)35(9,10)32-17-15-24(33-34(6,7)8)13-14-25(20-16-28-23(4,5)29-20)19(30-25)12-11-18(27)26(24)21(17)31-26/h17-21,27H,15-16H2,1-10H3/t17-,18+,19+,20-,21+,24+,25-,26+/m1/s1 |
| InChIKey | BQHQURIHRFRKIJ-JHOXUQFISA-N |
| XLogP | 3.18 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|