C10H14Br2 — CID 102446980
(1S,4S,6R,9R)-5,10-dibromotricyclo[7.1.0.04,6]decane (PubChem CID 102446980) has the molecular formula C10H14Br2 and a molecular weight of 294.03 g/mol. Its IUPAC name is (1S,4S,6R,9R)-5,10-dibromotricyclo[7.1.0.04,6]decane.
| Compound Name | (1S,4S,6R,9R)-5,10-dibromotricyclo[7.1.0.04,6]decane |
|---|---|
| PubChem CID | 102446980 |
| Molecular Formula | C10H14Br2 |
| Molecular Weight | 294.03 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | (1S,4S,6R,9R)-5,10-dibromotricyclo[7.1.0.04,6]decane |
| SMILES | BrC1[C@H]2CC[C@@H]3C(Br)[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C10H14Br2/c11-9-5-1-2-6-8(10(6)12)4-3-7(5)9/h5-10H,1-4H2/t5-,6-,7+,8+,9?,10? |
| InChIKey | KPDPRPOQGFEXEA-XKTNFCBFSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.03 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|