About CID 102446999
CID 102446999 (PubChem CID 102446999) has the molecular formula C16H16NO
and a molecular weight of 238.31 g/mol.
Molecular Properties
| Compound Name | CID 102446999 |
| PubChem CID | 102446999 |
| Molecular Formula | C16H16NO |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccc(CCc2ccc(CN=O)cc2)cc1 |
| InChI | InChI=1S/C16H16NO/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(11-9-15)12-17-18/h2-5,8-11H,1,6-7,12H2 |
| InChIKey | ZQLHWPYRAPQZDS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 102446999 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102446999?
The IUPAC name of CID 102446999 (CID 102446999) is not available.
What is the SMILES notation for CID 102446999?
The canonical SMILES for CID 102446999 is [CH2]c1ccc(CCc2ccc(CN=O)cc2)cc1.
What is the InChIKey of CID 102446999?
The InChIKey is ZQLHWPYRAPQZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16NO/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(11-9-15)12-17-18/h2-5,8-11H,1,6-7,12H2.
What are the key properties of CID 102446999?
CID 102446999 has a molecular weight of 238.31 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102446999 is sourced from PubChem (CID 102446999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).