About (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol
(2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol (PubChem CID 10244734) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol.
Molecular Properties
| Compound Name | (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol |
| PubChem CID | 10244734 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol |
| SMILES | CNC[C@H](c1ccc2ccccc2c1)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C18H25NO/c1-18(2,3)17(20)16(12-19-4)15-10-9-13-7-5-6-8-14(13)11-15/h5-11,16-17,19-20H,12H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | NMLVGYJWQMHSCP-SJORKVTESA-N |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol?
The IUPAC name of (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol (CID 10244734) is (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol.
What is the SMILES notation for (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol?
The canonical SMILES for (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol is CNC[C@H](c1ccc2ccccc2c1)[C@H](O)C(C)(C)C.
What is the InChIKey of (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol?
The InChIKey is NMLVGYJWQMHSCP-SJORKVTESA-N. The full InChI is InChI=1S/C18H25NO/c1-18(2,3)17(20)16(12-19-4)15-10-9-13-7-5-6-8-14(13)11-15/h5-11,16-17,19-20H,12H2,1-4H3/t16-,17+/m1/s1.
What are the key properties of (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol?
(2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol has a molecular weight of 271.40 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol is sourced from PubChem (CID 10244734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).