C18H52Si8 — CID 102448200
trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasilinan-1-yl]silane (PubChem CID 102448200) has the molecular formula C18H52Si8 and a molecular weight of 493.30 g/mol. Its IUPAC name is trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasilinan-1-yl]silane.
| Compound Name | trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasilinan-1-yl]silane |
|---|---|
| PubChem CID | 102448200 |
| Molecular Formula | C18H52Si8 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasilinan-1-yl]silane |
| SMILES | C[Si](C)(C)[Si]1([Si](C)(C)C)CC[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C18H52Si8/c1-19(2,3)25(20(4,5)6)17-18-26(21(7,8)9,22(10,11)12)24(15,16)23(25,13)14/h17-18H2,1-16H3 |
| InChIKey | WWKDEBDTYBKIRC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|