C16H44Si6 — CID 102448201
trimethyl-[1,4,4-tris(trimethylsilyl)-1,4-disilinan-1-yl]silane (PubChem CID 102448201) has the molecular formula C16H44Si6 and a molecular weight of 405.04 g/mol. Its IUPAC name is trimethyl-[1,4,4-tris(trimethylsilyl)-1,4-disilinan-1-yl]silane.
| Compound Name | trimethyl-[1,4,4-tris(trimethylsilyl)-1,4-disilinan-1-yl]silane |
|---|---|
| PubChem CID | 102448201 |
| Molecular Formula | C16H44Si6 |
| Molecular Weight | 405.04 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | trimethyl-[1,4,4-tris(trimethylsilyl)-1,4-disilinan-1-yl]silane |
| SMILES | C[Si](C)(C)[Si]1([Si](C)(C)C)CC[Si]([Si](C)(C)C)([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C16H44Si6/c1-17(2,3)21(18(4,5)6)13-15-22(16-14-21,19(7,8)9)20(10,11)12/h13-16H2,1-12H3 |
| InChIKey | WIAWRFQCXRHKMA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.04 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|