C14H16ClN3O3 — CID 10244857
4-(4-chlorophenyl)-1-hexanoyl-1,2,4-triazolidine-3,5-dione (PubChem CID 10244857) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-hexanoyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(4-chlorophenyl)-1-hexanoyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 10244857 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-(4-chlorophenyl)-1-hexanoyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCCCC(=O)n1[nH]c(=O)n(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C14H16ClN3O3/c1-2-3-4-5-12(19)18-14(21)17(13(20)16-18)11-8-6-10(15)7-9-11/h6-9H,2-5H2,1H3,(H,16,20) |
| InChIKey | KOPUYKZZYWDFJS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|