C34H37NO6 — CID 102448759
[3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate (PubChem CID 102448759) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is [3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate.
| Compound Name | [3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102448759 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | [3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCCCOc1ccc(/C=C/C(=O)Oc2cccc(/C=C/C(=O)c3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C34H37NO6/c1-2-3-4-5-6-7-8-9-25-40-31-21-13-27(14-22-31)16-24-34(37)41-32-12-10-11-28(26-32)15-23-33(36)29-17-19-30(20-18-29)35(38)39/h10-24,26H,2-9,25H2,1H3/b23-15+,24-16+ |
| InChIKey | MHJJWQIBOQCCGF-DFEHQXHXSA-N |
| XLogP | 8.63 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|