About CID 102448884
CID 102448884 (PubChem CID 102448884) has the molecular formula C58H66N7O8
and a molecular weight of 989.21 g/mol.
Molecular Properties
| Compound Name | CID 102448884 |
| PubChem CID | 102448884 |
| Molecular Formula | C58H66N7O8 |
| Molecular Weight | 989.21 g/mol |
| Exact Mass | 988.50 |
| IUPAC Name | — |
| SMILES | CN1[N]N(Cc2ccc(C#Cc3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)C=C1CCCCCCNCc1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C58H66N7O8/c1-64-50(45-65(63-64)44-47-20-17-46(18-21-47)19-22-48-40-53(51-13-7-10-26-60-51)62-54(41-48)52-14-8-11-27-61-52)12-4-2-3-9-25-59-43-49-23-24-57-58(42-49)73-39-35-69-31-30-67-33-37-71-56-16-6-5-15-55(56)70-36-32-66-28-29-68-34-38-72-57/h5-8,10-11,13-18,20-21,23-24,26-27,40-42,45,59H,2-4,9,12,25,28-39,43-44H2,1H3 |
| InChIKey | RHSJZIBCIMZYKS-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 145.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 989.21 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 102448884 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102448884?
The IUPAC name of CID 102448884 (CID 102448884) is not available.
What is the SMILES notation for CID 102448884?
The canonical SMILES for CID 102448884 is CN1[N]N(Cc2ccc(C#Cc3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)C=C1CCCCCCNCc1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2.
What is the InChIKey of CID 102448884?
The InChIKey is RHSJZIBCIMZYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C58H66N7O8/c1-64-50(45-65(63-64)44-47-20-17-46(18-21-47)19-22-48-40-53(51-13-7-10-26-60-51)62-54(41-48)52-14-8-11-27-61-52)12-4-2-3-9-25-59-43-49-23-24-57-58(42-49)73-39-35-69-31-30-67-33-37-71-56-16-6-5-15-55(56)70-36-32-66-28-29-68-34-38-72-57/h5-8,10-11,13-18,20-21,23-24,26-27,40-42,45,59H,2-4,9,12,25,28-39,43-44H2,1H3.
What are the key properties of CID 102448884?
CID 102448884 has a molecular weight of 989.21 g/mol, XLogP of 8.66, 13 rotatable bonds, 1 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102448884 is sourced from PubChem (CID 102448884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).