C11H8F6O3 — CID 102449260
1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxybenzoate (PubChem CID 102449260) has the molecular formula C11H8F6O3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxybenzoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxybenzoate |
|---|---|
| PubChem CID | 102449260 |
| Molecular Formula | C11H8F6O3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8F6O3/c1-19-7-4-2-6(3-5-7)8(18)20-9(10(12,13)14)11(15,16)17/h2-5,9H,1H3 |
| InChIKey | KSVIXPMZCHRKIS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |