C34H34O3 — CID 102449385
5,11,17-tritert-butyl-22-hydroxyhexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(20),2,4,6,9(21),10,12,15,17,19(22)-decaene-8,14-dione (PubChem CID 102449385) has the molecular formula C34H34O3 and a molecular weight of 490.64 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-22-hydroxyhexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(20),2,4,6,9(21),10,12,15,17,19(22)-decaene-8,14-dione.
| Compound Name | 5,11,17-tritert-butyl-22-hydroxyhexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(20),2,4,6,9(21),10,12,15,17,19(22)-decaene-8,14-dione |
|---|---|
| PubChem CID | 102449385 |
| Molecular Formula | C34H34O3 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 5,11,17-tritert-butyl-22-hydroxyhexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(20),2,4,6,9(21),10,12,15,17,19(22)-decaene-8,14-dione |
| SMILES | CC(C)(C)c1cc2c3c(c1)c(=O)c1cc(C(C)(C)C)cc4c(O)c5cc(C(C)(C)C)cc(c2=O)c5c-3c41 |
| InChI | InChI=1S/C34H34O3/c1-32(2,3)16-10-19-25-20(11-16)30(36)22-13-18(34(7,8)9)15-24-27(22)28(25)26-21(29(19)35)12-17(33(4,5)6)14-23(26)31(24)37/h10-15,35H,1-9H3 |
| InChIKey | VIXTZRRVNYWULR-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|