About 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran
5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran (PubChem CID 102449947) has the molecular formula C20H22O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran |
| PubChem CID | 102449947 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran |
| SMILES | CCCc1cc(-c2ccc(OC)cc2)cc2c(C)c(C)oc12 |
| InChI | InChI=1S/C20H22O2/c1-5-6-16-11-17(15-7-9-18(21-4)10-8-15)12-19-13(2)14(3)22-20(16)19/h7-12H,5-6H2,1-4H3 |
| InChIKey | WPCVMSNNGNUBMH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran?
The IUPAC name of 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran (CID 102449947) is 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran.
What is the SMILES notation for 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran?
The canonical SMILES for 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran is CCCc1cc(-c2ccc(OC)cc2)cc2c(C)c(C)oc12.
What is the InChIKey of 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran?
The InChIKey is WPCVMSNNGNUBMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O2/c1-5-6-16-11-17(15-7-9-18(21-4)10-8-15)12-19-13(2)14(3)22-20(16)19/h7-12H,5-6H2,1-4H3.
What are the key properties of 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran?
5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran has a molecular weight of 294.39 g/mol, XLogP of 5.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-2,3-dimethyl-7-propyl-1-benzofuran is sourced from PubChem (CID 102449947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).