C16H24O6 — CID 10244999
[6-(1,1-dimethoxy-5-methylhex-5-enyl)-5-oxo-2H-pyran-2-yl] acetate (PubChem CID 10244999) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is [6-(1,1-dimethoxy-5-methylhex-5-enyl)-5-oxo-2H-pyran-2-yl] acetate.
| Compound Name | [6-(1,1-dimethoxy-5-methylhex-5-enyl)-5-oxo-2H-pyran-2-yl] acetate |
|---|---|
| PubChem CID | 10244999 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [6-(1,1-dimethoxy-5-methylhex-5-enyl)-5-oxo-2H-pyran-2-yl] acetate |
| SMILES | C=C(C)CCCC(OC)(OC)C1OC(OC(C)=O)C=CC1=O |
| InChI | InChI=1S/C16H24O6/c1-11(2)7-6-10-16(19-4,20-5)15-13(18)8-9-14(22-15)21-12(3)17/h8-9,14-15H,1,6-7,10H2,2-5H3 |
| InChIKey | JURIFSALEOGJJG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|