About 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole
9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole (PubChem CID 10245014) has the molecular formula C20H16N4
and a molecular weight of 312.38 g/mol. Its IUPAC name is 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole.
Molecular Properties
| Compound Name | 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole |
| PubChem CID | 10245014 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole |
| SMILES | CCn1c2ccccc2c2cc(-c3nc4ccncc4[nH]3)ccc21 |
| InChI | InChI=1S/C20H16N4/c1-2-24-18-6-4-3-5-14(18)15-11-13(7-8-19(15)24)20-22-16-9-10-21-12-17(16)23-20/h3-12H,2H2,1H3,(H,22,23) |
| InChIKey | BSEFEFWNWWAMGX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole?
The IUPAC name of 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole (CID 10245014) is 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole.
What is the SMILES notation for 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole?
The canonical SMILES for 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole is CCn1c2ccccc2c2cc(-c3nc4ccncc4[nH]3)ccc21.
What is the InChIKey of 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole?
The InChIKey is BSEFEFWNWWAMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4/c1-2-24-18-6-4-3-5-14(18)15-11-13(7-8-19(15)24)20-22-16-9-10-21-12-17(16)23-20/h3-12H,2H2,1H3,(H,22,23).
What are the key properties of 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole?
9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole has a molecular weight of 312.38 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3-(3H-imidazo[4,5-c]pyridin-2-yl)carbazole is sourced from PubChem (CID 10245014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).