C25H46O3Si — CID 102450312
[8-[(E)-but-2-enyl]-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 102450312) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is [8-[(E)-but-2-enyl]-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [8-[(E)-but-2-enyl]-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102450312 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | [8-[(E)-but-2-enyl]-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C/C=C/CC1C2=COC(OC)(O[Si](C(C)C)(C(C)C)C(C)C)C(C)C2CCC1C |
| InChI | InChI=1S/C25H46O3Si/c1-11-12-13-22-20(8)14-15-23-21(9)25(26-10,27-16-24(22)23)28-29(17(2)3,18(4)5)19(6)7/h11-12,16-23H,13-15H2,1-10H3/b12-11+ |
| InChIKey | DOYUSBPBNBCUEG-VAWYXSNFSA-N |
| XLogP | 7.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|