C19H38N2 — CID 102450986
6-[(4aS,5R,7S,8aS)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]-N,N-dimethylhexan-1-amine (PubChem CID 102450986) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 6-[(4aS,5R,7S,8aS)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]-N,N-dimethylhexan-1-amine.
| Compound Name | 6-[(4aS,5R,7S,8aS)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]-N,N-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 102450986 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 6-[(4aS,5R,7S,8aS)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]-N,N-dimethylhexan-1-amine |
| SMILES | C[C@H]1C[C@@H](CCCCCCN(C)C)[C@@H]2CCCN(C)[C@H]2C1 |
| InChI | InChI=1S/C19H38N2/c1-16-14-17(10-7-5-6-8-12-20(2)3)18-11-9-13-21(4)19(18)15-16/h16-19H,5-15H2,1-4H3/t16-,17+,18-,19-/m0/s1 |
| InChIKey | HGLGMSLCYPFSOU-RDGPPVDQSA-N |
| XLogP | 4.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|