C25H5F15 — CID 102451121
2,5,8,11,20-pentakis(trifluoromethyl)hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene (PubChem CID 102451121) has the molecular formula C25H5F15 and a molecular weight of 590.29 g/mol. Its IUPAC name is 2,5,8,11,20-pentakis(trifluoromethyl)hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene.
| Compound Name | 2,5,8,11,20-pentakis(trifluoromethyl)hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene |
|---|---|
| PubChem CID | 102451121 |
| Molecular Formula | C25H5F15 |
| Molecular Weight | 590.29 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | 2,5,8,11,20-pentakis(trifluoromethyl)hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene |
| SMILES | FC(F)(F)c1cc2c(C(F)(F)F)cc3c(C(F)(F)F)cc4c(C(F)(F)F)cc5c(C(F)(F)F)cc1c1c5c4c3c21 |
| InChI | InChI=1S/C25H5F15/c26-21(27,28)11-1-6-12(22(29,30)31)3-8-14(24(35,36)37)5-10-15(25(38,39)40)4-9-13(23(32,33)34)2-7(11)17-16(6)18(8)20(10)19(9)17/h1-5H |
| InChIKey | ZRPFBUWEAZWMBU-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.29 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|