C16H19N9 — CID 102451157
4-[3,5-bis(1,2,4-triazol-4-yl)-1-adamantyl]-1,2,4-triazole (PubChem CID 102451157) has the molecular formula C16H19N9 and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-[3,5-bis(1,2,4-triazol-4-yl)-1-adamantyl]-1,2,4-triazole.
| Compound Name | 4-[3,5-bis(1,2,4-triazol-4-yl)-1-adamantyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 102451157 |
| Molecular Formula | C16H19N9 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-[3,5-bis(1,2,4-triazol-4-yl)-1-adamantyl]-1,2,4-triazole |
| SMILES | c1nncn1C12CC3CC(n4cnnc4)(C1)CC(n1cnnc1)(C3)C2 |
| InChI | InChI=1S/C16H19N9/c1-13-2-15(24-9-19-20-10-24)4-14(1,23-7-17-18-8-23)5-16(3-13,6-15)25-11-21-22-12-25/h7-13H,1-6H2 |
| InChIKey | IVOMBRZUANQQNC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |