About 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene
1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene (PubChem CID 102451448) has the molecular formula C24H20BrF3O2
and a molecular weight of 477.32 g/mol. Its IUPAC name is 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene |
| PubChem CID | 102451448 |
| Molecular Formula | C24H20BrF3O2 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene |
| SMILES | COc1ccc(C(/C=C(/Br)c2ccccc2C(F)(F)F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H20BrF3O2/c1-29-18-11-7-16(8-12-18)21(17-9-13-19(30-2)14-10-17)15-23(25)20-5-3-4-6-22(20)24(26,27)28/h3-15,21H,1-2H3/b23-15+ |
| InChIKey | DUUVDRHKAIWINO-HZHRSRAPSA-N |
| XLogP | 7.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene?
The IUPAC name of 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene (CID 102451448) is 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene.
What is the SMILES notation for 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene?
The canonical SMILES for 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene is COc1ccc(C(/C=C(/Br)c2ccccc2C(F)(F)F)c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene?
The InChIKey is DUUVDRHKAIWINO-HZHRSRAPSA-N. The full InChI is InChI=1S/C24H20BrF3O2/c1-29-18-11-7-16(8-12-18)21(17-9-13-19(30-2)14-10-17)15-23(25)20-5-3-4-6-22(20)24(26,27)28/h3-15,21H,1-2H3/b23-15+.
What are the key properties of 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene?
1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene has a molecular weight of 477.32 g/mol, XLogP of 7.29, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-2-(trifluoromethyl)benzene is sourced from PubChem (CID 102451448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).