C12H15N — CID 102451598
(2S)-2-methyl-6-phenyl-2,3,4,5-tetrahydropyridine (PubChem CID 102451598) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S)-2-methyl-6-phenyl-2,3,4,5-tetrahydropyridine.
| Compound Name | (2S)-2-methyl-6-phenyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 102451598 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2S)-2-methyl-6-phenyl-2,3,4,5-tetrahydropyridine |
| SMILES | C[C@H]1CCCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C12H15N/c1-10-6-5-9-12(13-10)11-7-3-2-4-8-11/h2-4,7-8,10H,5-6,9H2,1H3/t10-/m0/s1 |
| InChIKey | QXSFBHQVTQAPPI-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |