C10H9IN2O2 — CID 10245205
7-iodo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 10245205) has the molecular formula C10H9IN2O2 and a molecular weight of 316.10 g/mol. Its IUPAC name is 7-iodo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | 7-iodo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 10245205 |
| Molecular Formula | C10H9IN2O2 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 7-iodo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | CN1CC(=O)Nc2ccc(I)cc2C1=O |
| InChI | InChI=1S/C10H9IN2O2/c1-13-5-9(14)12-8-3-2-6(11)4-7(8)10(13)15/h2-4H,5H2,1H3,(H,12,14) |
| InChIKey | YRCOFMRMSBOZTI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|