C10H16O2Si — CID 102452092
(3aS,4R,6aR)-4-trimethylsilyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 102452092) has the molecular formula C10H16O2Si and a molecular weight of 196.32 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-trimethylsilyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | (3aS,4R,6aR)-4-trimethylsilyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 102452092 |
| Molecular Formula | C10H16O2Si |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (3aS,4R,6aR)-4-trimethylsilyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | C[Si](C)(C)[C@@H]1C=C[C@H]2COC(=O)[C@@H]12 |
| InChI | InChI=1S/C10H16O2Si/c1-13(2,3)8-5-4-7-6-12-10(11)9(7)8/h4-5,7-9H,6H2,1-3H3/t7-,8+,9+/m0/s1 |
| InChIKey | HRHBGORRYXWYAC-DJLDLDEBSA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|