C20H10Br2O2S — CID 102452326
9,15-dibromo-12λ6-thiapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene 12,12-dioxide (PubChem CID 102452326) has the molecular formula C20H10Br2O2S and a molecular weight of 474.17 g/mol. Its IUPAC name is 9,15-dibromo-12λ6-thiapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene 12,12-dioxide.
| Compound Name | 9,15-dibromo-12λ6-thiapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene 12,12-dioxide |
|---|---|
| PubChem CID | 102452326 |
| Molecular Formula | C20H10Br2O2S |
| Molecular Weight | 474.17 g/mol |
| Exact Mass | 471.88 |
| IUPAC Name | 9,15-dibromo-12λ6-thiapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene 12,12-dioxide |
| SMILES | O=S1(=O)c2cc(Br)c3ccccc3c2-c2c1cc(Br)c1ccccc21 |
| InChI | InChI=1S/C20H10Br2O2S/c21-15-9-17-19(13-7-3-1-5-11(13)15)20-14-8-4-2-6-12(14)16(22)10-18(20)25(17,23)24/h1-10H |
| InChIKey | TXEPBNGWFNXWFA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.17 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |