C13H22O6 — CID 102452388
methyl (E)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-2-methylprop-2-enoate (PubChem CID 102452388) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is methyl (E)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-2-methylprop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102452388 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl (E)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-2-methylprop-2-enoate |
| SMILES | COC(=O)/C(C)=C/[C@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C13H22O6/c1-9(11(14)15-4)7-10-8-18-12(2,16-5)13(3,17-6)19-10/h7,10H,8H2,1-6H3/b9-7+/t10-,12+,13+/m0/s1 |
| InChIKey | JRNJIWDAVNFCEC-AYLHFZKSSA-N |
| XLogP | 1.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|