C20H28O3 — CID 10245248
4-[2-[(3aS,7aS)-2-acetyl-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl]-2H-furan-5-one (PubChem CID 10245248) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-[2-[(3aS,7aS)-2-acetyl-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(3aS,7aS)-2-acetyl-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10245248 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-[2-[(3aS,7aS)-2-acetyl-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CC(=O)C1=C(CCC2=CCOC2=O)[C@@]2(C)CCCC(C)(C)[C@@H]2C1 |
| InChI | InChI=1S/C20H28O3/c1-13(21)15-12-17-19(2,3)9-5-10-20(17,4)16(15)7-6-14-8-11-23-18(14)22/h8,17H,5-7,9-12H2,1-4H3/t17-,20+/m0/s1 |
| InChIKey | MRQFLDWSKAQYHQ-FXAWDEMLSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |