C12H12O5 — CID 102452527
[(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]methyl acetate (PubChem CID 102452527) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is [(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]methyl acetate.
| Compound Name | [(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]methyl acetate |
|---|---|
| PubChem CID | 102452527 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]methyl acetate |
| SMILES | C=C1C(=O)O[C@@]2(COC(C)=O)C=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C12H12O5/c1-7-10-5-9(14)3-4-12(10,17-11(7)15)6-16-8(2)13/h3-4,10H,1,5-6H2,2H3/t10-,12+/m0/s1 |
| InChIKey | FXNNWZLYXZUUNS-CMPLNLGQSA-N |
| XLogP | 0.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|