C12H14O3 — CID 102452528
(3aS,7aS)-3a,7,7a-trimethyl-3-methylidene-4H-1-benzofuran-2,5-dione (PubChem CID 102452528) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3aS,7aS)-3a,7,7a-trimethyl-3-methylidene-4H-1-benzofuran-2,5-dione.
| Compound Name | (3aS,7aS)-3a,7,7a-trimethyl-3-methylidene-4H-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 102452528 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3aS,7aS)-3a,7,7a-trimethyl-3-methylidene-4H-1-benzofuran-2,5-dione |
| SMILES | C=C1C(=O)O[C@@]2(C)C(C)=CC(=O)C[C@@]12C |
| InChI | InChI=1S/C12H14O3/c1-7-5-9(13)6-11(3)8(2)10(14)15-12(7,11)4/h5H,2,6H2,1,3-4H3/t11-,12-/m0/s1 |
| InChIKey | ABXHMOPFDMXDTB-RYUDHWBXSA-N |
| XLogP | 1.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|