C8H16O4 — CID 102452701
2-(2-ethenoxyethoxy)-1,1-dimethoxyethane (PubChem CID 102452701) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-(2-ethenoxyethoxy)-1,1-dimethoxyethane.
| Compound Name | 2-(2-ethenoxyethoxy)-1,1-dimethoxyethane |
|---|---|
| PubChem CID | 102452701 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-(2-ethenoxyethoxy)-1,1-dimethoxyethane |
| SMILES | C=COCCOCC(OC)OC |
| InChI | InChI=1S/C8H16O4/c1-4-11-5-6-12-7-8(9-2)10-3/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | AJBCFEFQJCAPKL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|