C15H24O3 — CID 102452988
(3aR,7R,7aS)-7-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-1,3,3a,7a-tetrahydroinden-4-one (PubChem CID 102452988) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3aR,7R,7aS)-7-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-1,3,3a,7a-tetrahydroinden-4-one.
| Compound Name | (3aR,7R,7aS)-7-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-1,3,3a,7a-tetrahydroinden-4-one |
|---|---|
| PubChem CID | 102452988 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3aR,7R,7aS)-7-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-1,3,3a,7a-tetrahydroinden-4-one |
| SMILES | CC1=C(CCO)[C@](C)(O)[C@H]2CC(C)(C)C[C@H]2C1=O |
| InChI | InChI=1S/C15H24O3/c1-9-11(5-6-16)15(4,18)12-8-14(2,3)7-10(12)13(9)17/h10,12,16,18H,5-8H2,1-4H3/t10-,12+,15+/m1/s1 |
| InChIKey | GDXNPLSKAZEDPX-GMXABZIVSA-N |
| XLogP | 2.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |