C8H14Br2OS — CID 10245303
(2R,3R,5S)-3-[(1S)-1-bromoethyl]-5-(bromomethyl)-2-methyl-1,4-oxathiane (PubChem CID 10245303) has the molecular formula C8H14Br2OS and a molecular weight of 318.07 g/mol. Its IUPAC name is (2R,3R,5S)-3-[(1S)-1-bromoethyl]-5-(bromomethyl)-2-methyl-1,4-oxathiane.
| Compound Name | (2R,3R,5S)-3-[(1S)-1-bromoethyl]-5-(bromomethyl)-2-methyl-1,4-oxathiane |
|---|---|
| PubChem CID | 10245303 |
| Molecular Formula | C8H14Br2OS |
| Molecular Weight | 318.07 g/mol |
| Exact Mass | 315.91 |
| IUPAC Name | (2R,3R,5S)-3-[(1S)-1-bromoethyl]-5-(bromomethyl)-2-methyl-1,4-oxathiane |
| SMILES | C[C@H](Br)[C@@H]1S[C@H](CBr)CO[C@@H]1C |
| InChI | InChI=1S/C8H14Br2OS/c1-5(10)8-6(2)11-4-7(3-9)12-8/h5-8H,3-4H2,1-2H3/t5-,6+,7+,8-/m0/s1 |
| InChIKey | FZYQANFKMFQEHW-OSMVPFSASA-N |
| XLogP | 3.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.07 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|