C16H29NO3S — CID 102453283
(2S)-1-tert-butylsulfinyl-2-[2-(1,3-dioxan-2-yl)ethyl]-2,3,4,7-tetrahydroazepine (PubChem CID 102453283) has the molecular formula C16H29NO3S and a molecular weight of 315.48 g/mol. Its IUPAC name is (2S)-1-tert-butylsulfinyl-2-[2-(1,3-dioxan-2-yl)ethyl]-2,3,4,7-tetrahydroazepine.
| Compound Name | (2S)-1-tert-butylsulfinyl-2-[2-(1,3-dioxan-2-yl)ethyl]-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 102453283 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (2S)-1-tert-butylsulfinyl-2-[2-(1,3-dioxan-2-yl)ethyl]-2,3,4,7-tetrahydroazepine |
| SMILES | CC(C)(C)S(=O)N1CC=CCC[C@H]1CCC1OCCCO1 |
| InChI | InChI=1S/C16H29NO3S/c1-16(2,3)21(18)17-11-6-4-5-8-14(17)9-10-15-19-12-7-13-20-15/h4,6,14-15H,5,7-13H2,1-3H3/t14-,21?/m0/s1 |
| InChIKey | WWQRULAQQIPMSS-YXWRBFHGSA-N |
| XLogP | 3.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|