C22H34O9 — CID 102453469
methyl (2S,3S,4S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-carboxylate (PubChem CID 102453469) has the molecular formula C22H34O9 and a molecular weight of 442.51 g/mol. Its IUPAC name is methyl (2S,3S,4S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-carboxylate.
| Compound Name | methyl (2S,3S,4S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 102453469 |
| Molecular Formula | C22H34O9 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | methyl (2S,3S,4S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC=C(OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H34O9/c1-20(2,3)17(24)29-12-11-28-15(16(23)27-10)14(31-19(26)22(7,8)9)13(12)30-18(25)21(4,5)6/h11,13-15H,1-10H3/t13-,14+,15+/m1/s1 |
| InChIKey | MXUUKVWFNPYLHL-ILXRZTDVSA-N |
| XLogP | 2.90 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|