C48H46N4O2S4 — CID 102453609
(E)-2-cyano-3-[5-[4-hexyl-2-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102453609) has the molecular formula C48H46N4O2S4 and a molecular weight of 839.19 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-hexyl-2-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-hexyl-2-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102453609 |
| Molecular Formula | C48H46N4O2S4 |
| Molecular Weight | 839.19 g/mol |
| Exact Mass | 838.25 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-hexyl-2-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCc1nc(-c2nc(CCCCCC)c(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)s3)s2)sc1-c1ccc(/C=C(\C#N)C(=O)O)s1 |
| InChI | InChI=1S/C48H46N4O2S4/c1-3-5-7-15-21-39-44(42-28-27-38(55-42)31-34(32-49)48(53)54)57-46(50-39)47-51-40(22-16-8-6-4-2)45(58-47)43-30-29-41(56-43)33-23-25-37(26-24-33)52(35-17-11-9-12-18-35)36-19-13-10-14-20-36/h9-14,17-20,23-31H,3-8,15-16,21-22H2,1-2H3,(H,53,54)/b34-31+ |
| InChIKey | JCNSQWAPGZWYAK-WUVHBKSUSA-N |
| XLogP | 15.10 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.19 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|