About N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine
N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 10245368) has the molecular formula C9H9Br2N3
and a molecular weight of 319.00 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 10245368 |
| Molecular Formula | C9H9Br2N3 |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | Brc1cccc(Br)c1NC1=NCCN1 |
| InChI | InChI=1S/C9H9Br2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14) |
| InChIKey | XIVCHYWIEHVAJG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine (CID 10245368) is N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine is Brc1cccc(Br)c1NC1=NCCN1.
What is the InChIKey of N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is XIVCHYWIEHVAJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Br2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14).
What are the key properties of N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine?
N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 319.00 g/mol, XLogP of 2.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 10245368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).