C38H56O2Si2 — CID 102453781
[(16Z,21R,22R)-3,10-ditert-butyl-21,22-dimethyl-19-trimethylsilyloxy-14-pentacyclo[10.8.2.05,21.08,22.013,20]docosa-1(20),2,4,6,8,10,12,16-octaenyl]oxy-trimethylsilane (PubChem CID 102453781) has the molecular formula C38H56O2Si2 and a molecular weight of 601.04 g/mol. Its IUPAC name is [(16Z,21R,22R)-3,10-ditert-butyl-21,22-dimethyl-19-trimethylsilyloxy-14-pentacyclo[10.8.2.05,21.08,22.013,20]docosa-1(20),2,4,6,8,10,12,16-octaenyl]oxy-trimethylsilane.
| Compound Name | [(16Z,21R,22R)-3,10-ditert-butyl-21,22-dimethyl-19-trimethylsilyloxy-14-pentacyclo[10.8.2.05,21.08,22.013,20]docosa-1(20),2,4,6,8,10,12,16-octaenyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 102453781 |
| Molecular Formula | C38H56O2Si2 |
| Molecular Weight | 601.04 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | [(16Z,21R,22R)-3,10-ditert-butyl-21,22-dimethyl-19-trimethylsilyloxy-14-pentacyclo[10.8.2.05,21.08,22.013,20]docosa-1(20),2,4,6,8,10,12,16-octaenyl]oxy-trimethylsilane |
| SMILES | CC(C)(C)C1=CC2=C3C(=C4C=C(C(C)(C)C)C=C5C=CC(=C1)[C@@]2(C)[C@]54C)C(O[Si](C)(C)C)C/C=C\CC3O[Si](C)(C)C |
| InChI | InChI=1S/C38H56O2Si2/c1-35(2,3)27-21-25-19-20-26-22-28(36(4,5)6)24-30-34-32(40-42(12,13)14)18-16-15-17-31(39-41(9,10)11)33(34)29(23-27)37(25,7)38(26,30)8/h15-16,19-24,31-32H,17-18H2,1-14H3/b16-15-/t31?,32?,37-,38-/m1/s1 |
| InChIKey | ULXVDBIZXWQJLH-CIPHIHMKSA-N |
| XLogP | 10.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.04 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|