About 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid
2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid (PubChem CID 10245414) has the molecular formula C14H10ClN3O4
and a molecular weight of 319.70 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid |
| PubChem CID | 10245414 |
| Molecular Formula | C14H10ClN3O4 |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid |
| SMILES | Cc1onc2c(=O)n(CC(=O)O)nc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C14H10ClN3O4/c1-7-11-12(8-2-4-9(15)5-3-8)16-18(6-10(19)20)14(21)13(11)17-22-7/h2-5H,6H2,1H3,(H,19,20) |
| InChIKey | OBXKIMUQFXBWLI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid?
The IUPAC name of 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid (CID 10245414) is 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid.
What is the SMILES notation for 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid?
The canonical SMILES for 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid is Cc1onc2c(=O)n(CC(=O)O)nc(-c3ccc(Cl)cc3)c12.
What is the InChIKey of 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid?
The InChIKey is OBXKIMUQFXBWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN3O4/c1-7-11-12(8-2-4-9(15)5-3-8)16-18(6-10(19)20)14(21)13(11)17-22-7/h2-5H,6H2,1H3,(H,19,20).
What are the key properties of 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid?
2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid has a molecular weight of 319.70 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]acetic acid is sourced from PubChem (CID 10245414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).