C17H22O6 — CID 10245560
dimethyl (1R,5R)-1-hex-5-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate (PubChem CID 10245560) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is dimethyl (1R,5R)-1-hex-5-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate.
| Compound Name | dimethyl (1R,5R)-1-hex-5-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 10245560 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | dimethyl (1R,5R)-1-hex-5-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate |
| SMILES | C=CCCCC[C@]12CCC(=O)[C@H](O1)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C17H22O6/c1-4-5-6-7-9-17-10-8-11(18)14(23-17)12(15(19)21-2)13(17)16(20)22-3/h4,14H,1,5-10H2,2-3H3/t14-,17+/m0/s1 |
| InChIKey | INDVNXPAZSUYPL-WMLDXEAASA-N |
| XLogP | 1.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|