C14H21NO5 — CID 102455621
(3aR,6S,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethenyl-2,2-dimethyl-5-oxido-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 102455621) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is (3aR,6S,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethenyl-2,2-dimethyl-5-oxido-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aR,6S,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethenyl-2,2-dimethyl-5-oxido-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 102455621 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3aR,6S,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-ethenyl-2,2-dimethyl-5-oxido-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | C=CC1=[N+]([O-])[C@@H]([C@@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H21NO5/c1-6-8-11-12(20-14(4,5)19-11)10(15(8)16)9-7-17-13(2,3)18-9/h6,9-12H,1,7H2,2-5H3/t9-,10-,11+,12-/m0/s1 |
| InChIKey | VZDAPXYUVAYCOK-YFKTTZPYSA-N |
| XLogP | 1.18 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|