C26H21BN2O4 — CID 102455931
2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 102455931) has the molecular formula C26H21BN2O4 and a molecular weight of 436.28 g/mol. Its IUPAC name is 2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 102455931 |
| Molecular Formula | C26H21BN2O4 |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | CC1(C)COB(c2ccc(-c3nc4c5c(ccc4[nH]3)C(=O)c3ccccc3C5=O)cc2)OC1 |
| InChI | InChI=1S/C26H21BN2O4/c1-26(2)13-32-27(33-14-26)16-9-7-15(8-10-16)25-28-20-12-11-19-21(22(20)29-25)24(31)18-6-4-3-5-17(18)23(19)30/h3-12H,13-14H2,1-2H3,(H,28,29) |
| InChIKey | FXWGNSKCJZEUOW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|