About 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one
3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one (PubChem CID 10245675) has the molecular formula C15H15F3N4O
and a molecular weight of 324.31 g/mol. Its IUPAC name is 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one.
Molecular Properties
| Compound Name | 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one |
| PubChem CID | 10245675 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one |
| SMILES | O=c1c(N2CCNCC2)nccn1Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H15F3N4O/c16-11-8-13(18)12(17)7-10(11)9-22-6-3-20-14(15(22)23)21-4-1-19-2-5-21/h3,6-8,19H,1-2,4-5,9H2 |
| InChIKey | XSKYHZYWGSOTMJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one?
The IUPAC name of 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one (CID 10245675) is 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one.
What is the SMILES notation for 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one?
The canonical SMILES for 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one is O=c1c(N2CCNCC2)nccn1Cc1cc(F)c(F)cc1F.
What is the InChIKey of 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one?
The InChIKey is XSKYHZYWGSOTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N4O/c16-11-8-13(18)12(17)7-10(11)9-22-6-3-20-14(15(22)23)21-4-1-19-2-5-21/h3,6-8,19H,1-2,4-5,9H2.
What are the key properties of 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one?
3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one has a molecular weight of 324.31 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperazin-1-yl-1-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-one is sourced from PubChem (CID 10245675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).