C45H69Cl3Si3 — CID 102457322
1,1,2-trichloro-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane (PubChem CID 102457322) has the molecular formula C45H69Cl3Si3 and a molecular weight of 800.66 g/mol. Its IUPAC name is 1,1,2-trichloro-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane.
| Compound Name | 1,1,2-trichloro-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane |
|---|---|
| PubChem CID | 102457322 |
| Molecular Formula | C45H69Cl3Si3 |
| Molecular Weight | 800.66 g/mol |
| Exact Mass | 798.38 |
| IUPAC Name | 1,1,2-trichloro-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]trisilirane |
| SMILES | CC(C)c1cc(C(C)C)c([Si]2(Cl)[Si](Cl)(Cl)[Si]2(c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C45H69Cl3Si3/c1-25(2)34-19-37(28(7)8)43(38(20-34)29(9)10)49(44-39(30(11)12)21-35(26(3)4)22-40(44)31(13)14)50(46,51(49,47)48)45-41(32(15)16)23-36(27(5)6)24-42(45)33(17)18/h19-33H,1-18H3 |
| InChIKey | HBQQXNWVOIOHPA-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.66 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|