C21H27F3O3 — CID 102457393
ethyl (4E)-2-hydroxy-5,9-dimethyl-2-[4-(trifluoromethyl)phenyl]deca-4,8-dienoate (PubChem CID 102457393) has the molecular formula C21H27F3O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl (4E)-2-hydroxy-5,9-dimethyl-2-[4-(trifluoromethyl)phenyl]deca-4,8-dienoate.
| Compound Name | ethyl (4E)-2-hydroxy-5,9-dimethyl-2-[4-(trifluoromethyl)phenyl]deca-4,8-dienoate |
|---|---|
| PubChem CID | 102457393 |
| Molecular Formula | C21H27F3O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | ethyl (4E)-2-hydroxy-5,9-dimethyl-2-[4-(trifluoromethyl)phenyl]deca-4,8-dienoate |
| SMILES | CCOC(=O)C(O)(C/C=C(\C)CCC=C(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H27F3O3/c1-5-27-19(25)20(26,14-13-16(4)8-6-7-15(2)3)17-9-11-18(12-10-17)21(22,23)24/h7,9-13,26H,5-6,8,14H2,1-4H3/b16-13+ |
| InChIKey | JECCIDLDJFKBBE-DTQAZKPQSA-N |
| XLogP | 5.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|