C16H12F3N3 — CID 102457482
13-methyl-15-(trifluoromethyl)-10,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11,13,15-heptaene (PubChem CID 102457482) has the molecular formula C16H12F3N3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 13-methyl-15-(trifluoromethyl)-10,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11,13,15-heptaene.
| Compound Name | 13-methyl-15-(trifluoromethyl)-10,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11,13,15-heptaene |
|---|---|
| PubChem CID | 102457482 |
| Molecular Formula | C16H12F3N3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 13-methyl-15-(trifluoromethyl)-10,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11,13,15-heptaene |
| SMILES | Cc1cc(C(F)(F)F)c2nc3n(c2n1)CCc1ccccc1-3 |
| InChI | InChI=1S/C16H12F3N3/c1-9-8-12(16(17,18)19)13-15(20-9)22-7-6-10-4-2-3-5-11(10)14(22)21-13/h2-5,8H,6-7H2,1H3 |
| InChIKey | OINNPYLXCFNWIK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |