C60H63N3O12 — CID 102457697
3-[6-[4-[3,5-bis[4-[6-[(2-carboxy-3-pyridinyl)oxy]hexoxy]phenyl]phenyl]phenoxy]hexoxy]pyridine-2-carboxylic acid (PubChem CID 102457697) has the molecular formula C60H63N3O12 and a molecular weight of 1018.17 g/mol. Its IUPAC name is 3-[6-[4-[3,5-bis[4-[6-[(2-carboxy-3-pyridinyl)oxy]hexoxy]phenyl]phenyl]phenoxy]hexoxy]pyridine-2-carboxylic acid.
| Compound Name | 3-[6-[4-[3,5-bis[4-[6-[(2-carboxy-3-pyridinyl)oxy]hexoxy]phenyl]phenyl]phenoxy]hexoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 102457697 |
| Molecular Formula | C60H63N3O12 |
| Molecular Weight | 1018.17 g/mol |
| Exact Mass | 1017.44 |
| IUPAC Name | 3-[6-[4-[3,5-bis[4-[6-[(2-carboxy-3-pyridinyl)oxy]hexoxy]phenyl]phenyl]phenoxy]hexoxy]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncccc1OCCCCCCOc1ccc(-c2cc(-c3ccc(OCCCCCCOc4cccnc4C(=O)O)cc3)cc(-c3ccc(OCCCCCCOc4cccnc4C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C60H63N3O12/c64-58(65)55-52(16-13-31-61-55)73-37-10-4-1-7-34-70-49-25-19-43(20-26-49)46-40-47(44-21-27-50(28-22-44)71-35-8-2-5-11-38-74-53-17-14-32-62-56(53)59(66)67)42-48(41-46)45-23-29-51(30-24-45)72-36-9-3-6-12-39-75-54-18-15-33-63-57(54)60(68)69/h13-33,40-42H,1-12,34-39H2,(H,64,65)(H,66,67)(H,68,69) |
| InChIKey | MGSGUOBRYRFCJO-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 205.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.17 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|