C32H30N2O2S — CID 102457931
(3aS,8aS)-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,5,7,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepine-6-thione (PubChem CID 102457931) has the molecular formula C32H30N2O2S and a molecular weight of 506.67 g/mol. Its IUPAC name is (3aS,8aS)-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,5,7,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepine-6-thione.
| Compound Name | (3aS,8aS)-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,5,7,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepine-6-thione |
|---|---|
| PubChem CID | 102457931 |
| Molecular Formula | C32H30N2O2S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (3aS,8aS)-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,5,7,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepine-6-thione |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)C(c1ccccc1)(c1ccccc1)NC(=S)NC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30N2O2S/c1-30(2)35-27-28(36-30)32(25-19-11-5-12-20-25,26-21-13-6-14-22-26)34-29(37)33-31(27,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h3-22,27-28H,1-2H3,(H2,33,34,37)/t27-,28-/m1/s1 |
| InChIKey | PXAQMZMJKVXFIM-VSGBNLITSA-N |
| XLogP | 5.87 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|