C32H31F3N2O4S — CID 102457948
N-[[(4S,5S)-5-[amino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 102457948) has the molecular formula C32H31F3N2O4S and a molecular weight of 596.67 g/mol. Its IUPAC name is N-[[(4S,5S)-5-[amino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[[(4S,5S)-5-[amino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 102457948 |
| Molecular Formula | C32H31F3N2O4S |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | N-[[(4S,5S)-5-[amino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC1(C)O[C@@H](C(N)(c2ccccc2)c2ccccc2)[C@H](C(NS(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C32H31F3N2O4S/c1-29(2)40-27(30(36,23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(41-29)31(25-19-11-5-12-20-25,26-21-13-6-14-22-26)37-42(38,39)32(33,34)35/h3-22,27-28,37H,36H2,1-2H3/t27-,28-/m1/s1 |
| InChIKey | DXRZYBKEHWFDMF-VSGBNLITSA-N |
| XLogP | 5.79 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |