C24H34O9 — CID 102458574
[5-acetyloxy-4-[(1R,4R,6R)-1-[2-(2-hydroxy-2,6,6-trimethylcyclohexyl)ethyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate (PubChem CID 102458574) has the molecular formula C24H34O9 and a molecular weight of 466.53 g/mol. Its IUPAC name is [5-acetyloxy-4-[(1R,4R,6R)-1-[2-(2-hydroxy-2,6,6-trimethylcyclohexyl)ethyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate.
| Compound Name | [5-acetyloxy-4-[(1R,4R,6R)-1-[2-(2-hydroxy-2,6,6-trimethylcyclohexyl)ethyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate |
|---|---|
| PubChem CID | 102458574 |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [5-acetyloxy-4-[(1R,4R,6R)-1-[2-(2-hydroxy-2,6,6-trimethylcyclohexyl)ethyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate |
| SMILES | CC(=O)OC1C=C([C@H]2C[C@H]3O[C@@]3(CCC3C(C)(C)CCCC3(C)O)C(=O)O2)C(OC(C)=O)O1 |
| InChI | InChI=1S/C24H34O9/c1-13(25)29-19-11-15(20(32-19)30-14(2)26)16-12-18-24(33-18,21(27)31-16)10-7-17-22(3,4)8-6-9-23(17,5)28/h11,16-20,28H,6-10,12H2,1-5H3/t16-,17?,18-,19?,20?,23?,24-/m1/s1 |
| InChIKey | ZBQUIDQAXZXDFS-NKNVCQGGSA-N |
| XLogP | 2.53 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|