C19H20INO — CID 102458864
9-(1-iodoethenyl)-3,3,5,7-tetramethyl-2,4-dihydroacridin-1-one (PubChem CID 102458864) has the molecular formula C19H20INO and a molecular weight of 405.28 g/mol. Its IUPAC name is 9-(1-iodoethenyl)-3,3,5,7-tetramethyl-2,4-dihydroacridin-1-one.
| Compound Name | 9-(1-iodoethenyl)-3,3,5,7-tetramethyl-2,4-dihydroacridin-1-one |
|---|---|
| PubChem CID | 102458864 |
| Molecular Formula | C19H20INO |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 9-(1-iodoethenyl)-3,3,5,7-tetramethyl-2,4-dihydroacridin-1-one |
| SMILES | C=C(I)c1c2c(nc3c(C)cc(C)cc13)CC(C)(C)CC2=O |
| InChI | InChI=1S/C19H20INO/c1-10-6-11(2)18-13(7-10)16(12(3)20)17-14(21-18)8-19(4,5)9-15(17)22/h6-7H,3,8-9H2,1-2,4-5H3 |
| InChIKey | JDOAERVPHFPWDH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|