C17H28O8 — CID 102459498
(4R)-4-[(R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxan-5-one (PubChem CID 102459498) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is (4R)-4-[(R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxan-5-one.
| Compound Name | (4R)-4-[(R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 102459498 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (4R)-4-[(R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxan-5-one |
| SMILES | CC1(C)O[C@H]([C@@H](O)[C@H]2OC(C)(C)OCC2=O)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C17H28O8/c1-15(2)21-8-10(22-15)13-14(25-17(5,6)24-13)11(19)12-9(18)7-20-16(3,4)23-12/h10-14,19H,7-8H2,1-6H3/t10-,11+,12+,13-,14-/m1/s1 |
| InChIKey | MKVATTXMSUJCPX-MBJXGIAVSA-N |
| XLogP | 0.74 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |